Chemindex > 613-13-8
NL ▼
2-Aminoanthracene |
|
| Naam product | 2-Aminoanthracene |
| Engelse naam | 2-Aminoanthracene;2-anthramine practical grade*crystalline;2-anthrylamine;2-Anthramine;2-Anthranamine;anthracen-2-amine;2-Anthracenamide; |
| MF | C14H11N |
| Molecuulgewicht | 193.2438 |
| InChI | InChI=1/C14H11N/c15-14-6-5-12-7-10-3-1-2-4-11(10)8-13(12)9-14/h1-9H,15H2 |
| CAS-nummer | 613-13-8 |
| EINECS | 210-330-9 |
| Moleculaire Structuur |  |
| Dichtheid | 1.208g/cm3 |
| Smeltpunt | 238-241℃ |
| Kookpunt | 414.2°C at 760 mmHg |
| Brekingsindex | 1.765 |
| Vlampunt | 229°C |
| Dampdruk | 4.52E-07mmHg at 25°C |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R33##Danger of cummulative effects.:; |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 