ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
613-03-6 1,2,4-Triacetoxybenzene |
|
Naam product | 1,2,4-Triacetoxybenzene |
Engelse naam | 1,2,4-Triacetoxybenzene;1,2,4-Phenenyl triacetate;benzene-1,2,4-triyl triacetate;2-[(1-hydroxyethenyl)oxy]benzene-1,4-diyl diacetate |
MF | C12H12O6 |
Molecuulgewicht | 252.2201 |
InChI | InChI=1/C12H12O6/c1-7(13)16-10-4-5-11(17-8(2)14)12(6-10)18-9(3)15/h4-6,15H,3H2,1-2H3 |
CAS-nummer | 613-03-6 |
EINECS | 210-327-2 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.276g/cm3 |
Smeltpunt | 98-100℃ |
Kookpunt | 401°C at 760 mmHg |
Brekingsindex | 1.533 |
Vlampunt | 153.2°C |
Dampdruk | 3.77E-07mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |