Chemindex > 612-28-2
NL ▼
612-28-2 N-Methyl-2-nitroaniline |
|
| Naam product | N-Methyl-2-nitroaniline |
| Engelse naam | N-Methyl-2-nitroaniline;Benzenamine, N-methyl-2-nitro-;2-Nitro-N-methylaniline;4-12-00-01564 (Beilstein Handbook Reference);Aniline, N-methyl-o-nitro-;BRN 2209110;N-Methyl-2-nitrobenzenamine;N-Methyl-o-nitroaniline;NSC 86672;o-(Methylamino)nitrobenzene;o-Nitro-N-methylaniline |
| MF | C7H8N2O2 |
| Molecuulgewicht | 152.1506 |
| InChI | InChI=1/C7H8N2O2/c1-8-6-4-2-3-5-7(6)9(10)11/h2-5,8H,1H3 |
| CAS-nummer | 612-28-2 |
| EINECS | 210-303-1 |
| Moleculaire Structuur |  |
| Dichtheid | 1.26g/cm3 |
| Smeltpunt | 33-37℃ |
| Kookpunt | 277.9°C at 760 mmHg |
| Brekingsindex | 1.619 |
| Vlampunt | 121.9°C |
| Dampdruk | 0.0044mmHg at 25°C |
| Gevaarsymbolen |  T##Toxic:; |
| Risico-codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.:; |
| Veiligheid Omschrijving | S28A##After contact with skin, wash immediately with plenty of water.||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 