ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
3,3'-Diaminobenzophenone |
|
Naam product | 3,3'-Diaminobenzophenone |
Engelse naam | 3,3'-Diaminobenzophenone;bis(3-aminophenyl)methanone |
MF | C13H12N2O |
Molecuulgewicht | 212.2472 |
InChI | InChI=1/C13H12N2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H,14-15H2 |
CAS-nummer | 611-79-0 |
EINECS | 210-281-3 |
Moleculaire Structuur | |
Dichtheid | 1.233g/cm3 |
Kookpunt | 469.4°C at 760 mmHg |
Brekingsindex | 1.673 |
Vlampunt | 237.7°C |
Dampdruk | 5.51E-09mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |