Chemindex > 610-69-5
NL ▼
610-69-5 2-nitrofenylacetaat |
|
| Naam product | 2-nitrofenylacetaat |
| Synoniemen | 2-nitrofenylacetaat; Azijnzuur-2-nitrofenylester; |
| Engelse naam | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
| MF | C8H7NO4 |
| Molecuulgewicht | 181.1455 |
| InChI | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
| CAS-nummer | 610-69-5 |
| EINECS | 210-233-1 |
| Moleculaire Structuur |  |
| Dichtheid | 1.304g/cm3 |
| Smeltpunt | 39-41℃ |
| Kookpunt | 274.8°C at 760 mmHg |
| Brekingsindex | 1.548 |
| Vlampunt | 139.8°C |
| Dampdruk | 0.00528mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 610-69-5 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 