ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-69-5 2-nitrofenylacetaat |
|
Naam product | 2-nitrofenylacetaat |
Synoniemen | 2-nitrofenylacetaat; Azijnzuur-2-nitrofenylester; |
Engelse naam | 2-nitrophenyl acetate;2-Nitrophenyl acetate;Acetic acid 2-nitrophenyl ester |
MF | C8H7NO4 |
Molecuulgewicht | 181.1455 |
InChI | InChI=1/C8H7NO4/c1-6(10)13-8-5-3-2-4-7(8)9(11)12/h2-5H,1H3 |
CAS-nummer | 610-69-5 |
EINECS | 210-233-1 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.304g/cm3 |
Smeltpunt | 39-41℃ |
Kookpunt | 274.8°C at 760 mmHg |
Brekingsindex | 1.548 |
Vlampunt | 139.8°C |
Dampdruk | 0.00528mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |