ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-28-6 2,5-dinitrobenzoic acid |
|
Naam product | 2,5-dinitrobenzoic acid |
Engelse naam | 2,5-dinitrobenzoic acid;2,5-Dinitrobenzoic acid;4-09-00-01241 (Beilstein Handbook Reference);BRN 1983247;CCRIS 3127;NSC 3810;Benzoic acid, 2,5-dinitro-;2,5-dinitrobenzoate |
MF | C7H3N2O6 |
Molecuulgewicht | 211.1091 |
InChI | InChI=1/C7H4N2O6/c10-7(11)5-3-4(8(12)13)1-2-6(5)9(14)15/h1-3H,(H,10,11)/p-1 |
CAS-nummer | 610-28-6 |
EINECS | 210-216-9 |
Moleculaire Structuur | ![]() |
Smeltpunt | 180℃ |
Kookpunt | 419.6°C at 760 mmHg |
Vlampunt | 190.5°C |
Dampdruk | 8.59E-08mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |