ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
610-16-2 2-Dimethylaminobenzoic acid |
|
Naam product | 2-Dimethylaminobenzoic acid |
Engelse naam | 2-Dimethylaminobenzoic acid;Benzoic acid, 2-(dimethylamino)-;2-(Dimethylamino)benzoic acid;AI3-05925;N,N-Dimethylanthranilic acid;NSC 45790;Anthranilic acid, N,N-dimethyl- (8CI);2-(dimethylamino)benzoate |
MF | C9H10NO2 |
Molecuulgewicht | 164.1817 |
InChI | InChI=1/C9H11NO2/c1-10(2)8-6-4-3-5-7(8)9(11)12/h3-6H,1-2H3,(H,11,12)/p-1 |
CAS-nummer | 610-16-2 |
EINECS | 210-209-0 |
Moleculaire Structuur | |
Smeltpunt | 71-72℃ |
Kookpunt | 288.5°C at 760 mmHg |
Vlampunt | 128.3°C |
Dampdruk | 0.00108mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |