Chemindex > 609-11-0
NL ▼
609-11-0 Ethyl 2,3-dibromobutyrate |
|
| Naam product | Ethyl 2,3-dibromobutyrate |
| Engelse naam | Ethyl 2,3-dibromobutyrate;2,3-Dibromobutyric acid ethyl ester;2,3-Dibromo-n-butyric acid ethyl ester;ethyl 2,3-dibromobutanoate |
| MF | C6H10Br2O2 |
| Molecuulgewicht | 273.9504 |
| InChI | InChI=1/C6H10Br2O2/c1-3-10-6(9)5(8)4(2)7/h4-5H,3H2,1-2H3 |
| CAS-nummer | 609-11-0 |
| EINECS | 210-177-8 |
| Moleculaire Structuur |  |
| Dichtheid | 1.731g/cm3 |
| Kookpunt | 226.7°C at 760 mmHg |
| Brekingsindex | 1.506 |
| Vlampunt | 90.9°C |
| Dampdruk | 0.0809mmHg at 25°C |
| Risico-codes | R34##Causes burns.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 609-11-0 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 