ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
BHC of HCH |
|
Naam product | BHC of HCH |
Synoniemen | ; benzeenhexachloride; 1,2,3,4,5,6-hexachloorcyclohexaan; |
Engelse naam | BHC or HCH;benzene hexachloride;1,2,3,4,5,6-hexachlorocyclohexane |
MF | C6H6Cl6 |
Molecuulgewicht | 290.8298 |
InChI | InChI=1/C6H6Cl6/c7-1-2(8)4(10)6(12)5(11)3(1)9/h1-6H |
CAS-nummer | 608-73-1 |
EINECS | 210-168-9 |
Moleculaire Structuur | |
Dichtheid | 1.59g/cm3 |
Kookpunt | 288°C at 760 mmHg |
Brekingsindex | 1.532 |
Vlampunt | 157.5°C |
Dampdruk | 0.00416mmHg at 25°C |
MSDS |