ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
607-28-3 Isatin-3-oxime |
|
Naam product | Isatin-3-oxime |
Engelse naam | Isatin-3-oxime;3-hydroxyiminoindolin-2-one;beta-Isatoxime;3-(hydroxyamino)-2H-indol-2-one |
MF | C8H6N2O2 |
Molecuulgewicht | 162.1454 |
InChI | InChI=1/C8H6N2O2/c11-8-7(10-12)5-3-1-2-4-6(5)9-8/h1-4,12H,(H,9,10,11) |
CAS-nummer | 607-28-3 |
EINECS | 210-132-2 |
Moleculaire Structuur | |
Dichtheid | 1.49g/cm3 |
Smeltpunt | 210-214℃ |
Kookpunt | 400.5°C at 760 mmHg |
Brekingsindex | 1.706 |
Vlampunt | 196°C |
Dampdruk | 4.43E-08mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |