ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Alpha-Naphthoflavone |
|
Naam product | Alpha-Naphthoflavone |
Engelse naam | Alpha-Naphthoflavone;7,8-Benzoflavone;2-phenylbenzo(h)chromen-4-one;2-phenyl-4H-benzo[h]chromen-4-one |
MF | C19H12O2 |
Molecuulgewicht | 272.2974 |
InChI | InChI=1/C19H12O2/c20-17-12-18(14-7-2-1-3-8-14)21-19-15-9-5-4-6-13(15)10-11-16(17)19/h1-12H |
CAS-nummer | 604-59-1 |
EINECS | 210-071-1 |
Moleculaire Structuur | |
Dichtheid | 1.276g/cm3 |
Smeltpunt | 155-157℃ |
Kookpunt | 460.9°C at 760 mmHg |
Brekingsindex | 1.695 |
Vlampunt | 215.8°C |
Dampdruk | 1.12E-08mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |