Chemindex > 604-44-4
NL ▼
604-44-4 4-Chloro-1-naphthol |
|
| Naam product | 4-Chloro-1-naphthol |
| Engelse naam | 4-Chloro-1-naphthol;1-Chloro-4-hydroxynaphthalene;4-Chloro-alpha-naphthol;NSC 44345;1-Naphthalenol, 4-chloro-;1-Naphthol, 4-chloro- (8CI);4-chloronaphthalen-1-ol |
| MF | C10H7ClO |
| Molecuulgewicht | 178.615 |
| InChI | InChI=1/C10H7ClO/c11-9-5-6-10(12)8-4-2-1-3-7(8)9/h1-6,12H |
| CAS-nummer | 604-44-4 |
| EINECS | 210-068-5 |
| Moleculaire Structuur |  |
| Dichtheid | 1.333g/cm3 |
| Smeltpunt | 117-120℃ |
| Kookpunt | 332.1°C at 760 mmHg |
| Brekingsindex | 1.684 |
| Vlampunt | 154.6°C |
| Dampdruk | 7.74E-05mmHg at 25°C |
| Gevaarsymbolen |  Xi##Irritant:; |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 