Chemindex > 602-87-9
NL ▼
602-87-9 5-Nitroacenaphthene |
|
| Naam product | 5-Nitroacenaphthene |
| Engelse naam | 5-Nitroacenaphthene;1,2-Dihydro-5-nitro-acenaphthylene;4-05-00-01840 (Beilstein Handbook Reference);5-Nan;5-Nitroacenaphthylene;5-Nitroacenapthene;5-Nitronaphthalene;5-Nitronaphthalene ethylene;Acenaphthene, 5-nitro-;Acenaphthylene, 1,2-dihydro-5-nitro-;BRN 1876864;CCRIS 438;HSDB 4092;NCI-C01967;NSC 1312;NSC 22421;1,2-Dihydro-5-nitroacenaphthylene;5-nitro-1,2-dihydroacenaphthylene;Nitroacenaphthene;1,2-dihydro-5-nitro-acenaphthylen |
| MF | C12H7NO2 |
| Molecuulgewicht | 197.1895 |
| InChI | InChI=1/C12H7NO2/c14-13(15)11-7-6-9-5-4-8-2-1-3-10(11)12(8)9/h1-7H |
| CAS-nummer | 602-87-9 |
| EINECS | 210-025-0 |
| Moleculaire Structuur |  |
| Dichtheid | 1.408g/cm3 |
| Smeltpunt | 101-102℃ |
| Kookpunt | 381.6°C at 760 mmHg |
| Brekingsindex | 1.763 |
| Vlampunt | 196.7°C |
| Dampdruk | 1.1E-05mmHg at 25°C |
| Risico-codes | R45##May cause cancer.:; |
| Veiligheid Omschrijving | S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 