ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9-nitroanthracene |
|
Naam product | 9-nitroanthracene |
Engelse naam | 9-nitroanthracene;9-Nitroanthracene (purity);1-nitroanthracene |
MF | C14H9NO2 |
Molecuulgewicht | 223.2268 |
InChI | InChI=1/C14H9NO2/c16-15(17)14-7-3-6-12-8-10-4-1-2-5-11(10)9-13(12)14/h1-9H |
CAS-nummer | 602-60-8 |
EINECS | 210-021-9 |
Moleculaire Structuur | |
Dichtheid | 1.316g/cm3 |
Smeltpunt | 144-144℃ |
Kookpunt | 413.3°C at 760 mmHg |
Brekingsindex | 1.741 |
Vlampunt | 207.5°C |
Dampdruk | 1.16E-06mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |