ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
9-Phenylanthracene |
|
Naam product | 9-Phenylanthracene |
Engelse naam | 9-Phenylanthracene;Phenylanthracene;anthracene,9-phenyl-;9-phenylantracene |
MF | C20H14 |
Molecuulgewicht | 254.3252 |
InChI | InChI=1/C20H14/c1-2-8-15(9-3-1)20-18-12-6-4-10-16(18)14-17-11-5-7-13-19(17)20/h1-14H |
CAS-nummer | 602-55-1 |
EINECS | 210-019-8 |
Moleculaire Structuur | |
Dichtheid | 1.14g/cm3 |
Smeltpunt | 149-153℃ |
Kookpunt | 417°C at 760 mmHg |
Brekingsindex | 1.703 |
Vlampunt | 192.1°C |
Dampdruk | 8.86E-07mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |