Chemindex > 58414-52-1
NL â–¼
58414-52-1 Methyl thiophene-3-acetate |
|
| Naam product | Methyl thiophene-3-acetate |
| Engelse naam | Methyl thiophene-3-acetate;Methyl 3-thienylacetate~Thiophene-3-acetic acid methyl ester;3-Thiopheneacetic acid methyl ester;methyl thiophen-3-ylacetate |
| MF | C7H8O2S |
| Molecuulgewicht | 156.2022 |
| InChI | InChI=1/C7H8O2S/c1-9-7(8)4-6-2-3-10-5-6/h2-3,5H,4H2,1H3 |
| CAS-nummer | 58414-52-1 |
| EINECS | 261-242-2 |
| Moleculaire Structuur |  |
| Dichtheid | 1.185g/cm3 |
| Kookpunt | 210.4°C at 760 mmHg |
| Brekingsindex | 1.528 |
| Vlampunt | 81.1°C |
| Dampdruk | 0.193mmHg at 25°C |
| Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 58414-52-1 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 