ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58026-14-5 4-Benzyloxy-2-methoxybenzaldehyde |
|
Naam product | 4-Benzyloxy-2-methoxybenzaldehyde |
Engelse naam | 4-Benzyloxy-2-methoxybenzaldehyde;4-Benzyloxy-o-anisaldehyde |
MF | C15H14O3 |
Molecuulgewicht | 242.2699 |
InChI | InChI=1/C15H14O3/c1-17-15-9-14(8-7-13(15)10-16)18-11-12-5-3-2-4-6-12/h2-10H,11H2,1H3 |
CAS-nummer | 58026-14-5 |
Moleculaire Structuur | |
Dichtheid | 1.154g/cm3 |
Kookpunt | 412.2°C at 760 mmHg |
Brekingsindex | 1.59 |
Vlampunt | 194.8°C |
Dampdruk | 5.28E-07mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |