ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
58-61-7 Adenosine |
|
Naam product | Adenosine |
Engelse naam | Adenosine;adenosine free base;6-Amino-9-(beta-D-ribofuranosyl)9H-purine;9-alpha-D-lyxofuranosyl-9H-purin-6-amine;AR |
MF | C10H13N5O4 |
Molecuulgewicht | 267.2413 |
InChI | InChI=1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6+,7+,10+/m1/s1 |
CAS-nummer | 58-61-7 |
EINECS | 200-389-9 |
Moleculaire Structuur | |
Dichtheid | 2.08g/cm3 |
Smeltpunt | 234-236℃ |
Kookpunt | 676.3°C at 760 mmHg |
Brekingsindex | 1.907 |
Vlampunt | 362.8°C |
Dampdruk | 3.26E-19mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |