ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57878-93-0 2-chloro-4-methylphenyl isothiocyanate |
|
Naam product | 2-chloro-4-methylphenyl isothiocyanate |
Engelse naam | 2-chloro-4-methylphenyl isothiocyanate;2-Chloro-4-methylphenyl isothiocyanate;2-chloro-1-isothiocyanato-4-methylbenzene |
MF | C8H6ClNS |
Molecuulgewicht | 183.6579 |
InChI | InChI=1/C8H6ClNS/c1-6-2-3-8(10-5-11)7(9)4-6/h2-4H,1H3 |
CAS-nummer | 57878-93-0 |
Moleculaire Structuur | |
Dichtheid | 1.18g/cm3 |
Kookpunt | 286.8°C at 760 mmHg |
Brekingsindex | 1.583 |
Vlampunt | 127.3°C |
Dampdruk | 0.00444mmHg at 25°C |
Gevaarsymbolen | Xn##Harmful:; |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |