578-46-1 5-Methyl-2-nitroaniline |
| Naam product |
5-Methyl-2-nitroaniline |
| Engelse naam |
5-Methyl-2-nitroaniline;3-Amino-4-nitrotoluene;6-Nitro-m-toluidine;5-Methyl-2-nitrophenylamine;5-Methyl-2-nitro phenylamine |
| MF |
C7H8N2O2 |
| Molecuulgewicht |
152.1506 |
| InChI |
InChI=1/C7H8N2O2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,8H2,1H3 |
| CAS-nummer |
578-46-1 |
| EINECS |
209-423-7 |
| Moleculaire Structuur |
 |
| Dichtheid |
1.269g/cm3 |
| Kookpunt |
312.4°C at 760 mmHg |
| Brekingsindex |
1.615 |
| Vlampunt |
142.8°C |
| Dampdruk |
0.000529mmHg at 25°C |
| Risico-codes |
R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R33##Danger of cummulative effects.||R51/53##Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.:;
|
| Veiligheid Omschrijving |
S28##After contact with skin, wash immediately with plenty of ...||S36/37##Wear suitable protective clothing and gloves.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S61##Avoid release to the environment. Refer to special instructions / Safety data sheets.:;
|
| MSDS |
Material Safety Data Sheet |
NL ▼
