ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
571-61-9 1,5-Dimethylnaphthalene |
|
Naam product | 1,5-Dimethylnaphthalene |
Engelse naam | 1,5-Dimethylnaphthalene;NSC 59388;Naphthalene, 1,5-dimethyl-;Naphthalene, 1,5-dimethyl- (8CI)(9CI);N-methyl-N-nitrosomethanamine |
MF | C12H12 |
Molecuulgewicht | 156.2237 |
InChI | InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
CAS-nummer | 571-61-9 |
EINECS | 209-338-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1g/cm3 |
Smeltpunt | 78-266℃ |
Kookpunt | 265.6°C at 760 mmHg |
Brekingsindex | 1.604 |
Vlampunt | 111.4°C |
Dampdruk | 0.0149mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |