ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
571-61-9 1,5-Dimethylnaphthalene |
|
| Naam product | 1,5-Dimethylnaphthalene |
| Engelse naam | 1,5-Dimethylnaphthalene;NSC 59388;Naphthalene, 1,5-dimethyl-;Naphthalene, 1,5-dimethyl- (8CI)(9CI);N-methyl-N-nitrosomethanamine |
| MF | C12H12 |
| Molecuulgewicht | 156.2237 |
| InChI | InChI=1/C12H12/c1-9-5-3-8-12-10(2)6-4-7-11(9)12/h3-8H,1-2H3 |
| CAS-nummer | 571-61-9 |
| EINECS | 209-338-5 |
| Moleculaire Structuur | ![]() |
| Dichtheid | 1g/cm3 |
| Smeltpunt | 78-266℃ |
| Kookpunt | 265.6°C at 760 mmHg |
| Brekingsindex | 1.604 |
| Vlampunt | 111.4°C |
| Dampdruk | 0.0149mmHg at 25°C |
| Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |