ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Diethylstilbestrol |
|
Naam product | Diethylstilbestrol |
Engelse naam | Diethylstilbestrol;Stilboestrol;a,a-Diethyl-4,4-Stilbenediol Carc.;Atovaquone;4,4'-(3E)-hex-3-ene-3,4-diyldiphenol;4,4'-(3Z)-hex-3-ene-3,4-diyldiphenol;diethylstilbestrol, mixture of cis and trans;Diethylstilbestrol,mixture of cis and trans;Diethylstilbestrol BP |
MF | C18H20O2 |
Molecuulgewicht | 268.3502 |
InChI | InChI=1/C18H20O2/c1-3-17(13-5-9-15(19)10-6-13)18(4-2)14-7-11-16(20)12-8-14/h5-12,19-20H,3-4H2,1-2H3/b18-17- |
CAS-nummer | 56-53-1;6898-97-1 |
EINECS | 200-278-5 |
Moleculaire Structuur | |
Dichtheid | 1.107g/cm3 |
Smeltpunt | 169-175℃ |
Kookpunt | 407.1°C at 760 mmHg |
Brekingsindex | 1.603 |
Vlampunt | 187°C |
Oplosbaarheid in water | PRACTICALLY INSOLUBLE |
Dampdruk | 3.29E-07mmHg at 25°C |
Gevaarsymbolen | T##Toxic||N##Dangerous for the environment:; |
Risico-codes | R40||R45||R61||R36/37/38||R51/53:; |
Veiligheid Omschrijving | S36/37/39||S45||S53||S60||S61:; |
MSDS |