ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
55708-65-1 4-Benzyloxy-3-methoxystyrene |
|
Naam product | 4-Benzyloxy-3-methoxystyrene |
Engelse naam | 4-Benzyloxy-3-methoxystyrene;2-benzyloxy-5-vinylanisole;1-(benzyloxy)-4-ethenyl-2-methoxybenzene |
MF | C16H16O2 |
Molecuulgewicht | 240.297 |
InChI | InChI=1/C16H16O2/c1-3-13-9-10-15(16(11-13)17-2)18-12-14-7-5-4-6-8-14/h3-11H,1,12H2,2H3 |
CAS-nummer | 55708-65-1 |
EINECS | 259-771-9 |
Moleculaire Structuur | |
Dichtheid | 1.072g/cm3 |
Smeltpunt | 48-55℃ |
Kookpunt | 371.3°C at 760 mmHg |
Brekingsindex | 1.584 |
Vlampunt | 147.6°C |
Dampdruk | 2.23E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |