ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5524-05-0 (+)-Dihydrocarvone |
|
Naam product | (+)-Dihydrocarvone |
Engelse naam | (+)-Dihydrocarvone;(+)-Dihydrocarvone, mixture of isomers;p-Menth-8(9)-en-2-one;8-p-Menthen-2-one;(2R,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone;(2S,5R)-2-methyl-5-(prop-1-en-2-yl)cyclohexanone |
MF | C10H16O |
Molecuulgewicht | 152.2334 |
InChI | InChI=1/C10H16O/c1-7(2)9-5-4-8(3)10(11)6-9/h8-9H,1,4-6H2,2-3H3/t8-,9+/m0/s1 |
CAS-nummer | 5524-05-0 |
EINECS | 226-872-4 |
Moleculaire Structuur | |
Dichtheid | 0.903g/cm3 |
Kookpunt | 221.5°C at 760 mmHg |
Brekingsindex | 1.457 |
Vlampunt | 82.6°C |
Dampdruk | 0.107mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |