ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54589-41-2 4-Benzyloxybenzophenone |
|
Naam product | 4-Benzyloxybenzophenone |
Engelse naam | 4-Benzyloxybenzophenone;[4-(benzyloxy)phenyl](phenyl)methanone |
MF | C20H16O2 |
Molecuulgewicht | 288.3398 |
InChI | InChI=1/C20H16O2/c21-20(17-9-5-2-6-10-17)18-11-13-19(14-12-18)22-15-16-7-3-1-4-8-16/h1-14H,15H2 |
CAS-nummer | 54589-41-2 |
Moleculaire Structuur | |
Dichtheid | 1.143g/cm3 |
Kookpunt | 451.2°C at 760 mmHg |
Brekingsindex | 1.607 |
Vlampunt | 199.1°C |
Dampdruk | 2.48E-08mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |