ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2-Acetamidofluorene |
|
Naam product | 2-Acetamidofluorene |
Engelse naam | 2-Acetamidofluorene;N-(2-Fluorenyl)acetamide;Acetamidofluorene;N-(9H-fluoren-2-yl)acetamide;2-(9H-fluoren-2-yl)acetamide |
MF | C15H13NO |
Molecuulgewicht | 223.2698 |
InChI | InChI=1/C15H13NO/c16-15(17)8-10-5-6-14-12(7-10)9-11-3-1-2-4-13(11)14/h1-7H,8-9H2,(H2,16,17) |
CAS-nummer | 53-96-3 |
EINECS | 200-188-6 |
Moleculaire Structuur | |
Dichtheid | 1.227g/cm3 |
Smeltpunt | 192-196℃ |
Kookpunt | 471.2°C at 760 mmHg |
Brekingsindex | 1.656 |
Vlampunt | 238.8°C |
Oplosbaarheid in water | 0.000529 g/100 mL |
Dampdruk | 4.73E-09mmHg at 25°C |
Gevaarsymbolen | T##Toxic:; |
Risico-codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R46##May cause heritable genetic damages.:; |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |