ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
52085-14-0 4-Benzyloxy-2-hydroxybenzaldehyde |
|
Naam product | 4-Benzyloxy-2-hydroxybenzaldehyde |
Engelse naam | 4-Benzyloxy-2-hydroxybenzaldehyde;4-Benzyloxysalicylaldehyde;4-(benzyloxy)-2-hydroxybenzaldehyde |
MF | C14H12O3 |
Molecuulgewicht | 228.2433 |
InChI | InChI=1/C14H12O3/c15-9-12-6-7-13(8-14(12)16)17-10-11-4-2-1-3-5-11/h1-9,16H,10H2 |
CAS-nummer | 52085-14-0 |
Moleculaire Structuur | |
Dichtheid | 1.238g/cm3 |
Kookpunt | 390.9°C at 760 mmHg |
Brekingsindex | 1.636 |
Vlampunt | 149.9°C |
Dampdruk | 1.14E-06mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |