ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
2,4-Dinitrophenol |
|
Naam product | 2,4-Dinitrophenol |
Engelse naam | 2,4-Dinitrophenol;2,4-dinitrophenol moistened with water (H(2)O ~20%);2,4-dinitrophenol, reagent grade;2,4-dinitrophenol, industry grade;2,4-dinitrophenolate |
MF | C6H3N2O5 |
Molecuulgewicht | 183.099 |
InChI | InChI=1/C6H4N2O5/c9-6-2-1-4(7(10)11)3-5(6)8(12)13/h1-3,9H/p-1 |
CAS-nummer | 51-28-5 |
EINECS | 200-087-7 |
Moleculaire Structuur | |
Smeltpunt | 106-112℃ |
Kookpunt | 312.1°C at 760 mmHg |
Vlampunt | 142.8°C |
Oplosbaarheid in water | 0.6 g/100 mL (18℃) |
Dampdruk | 0.000294mmHg at 25°C |
Gevaarsymbolen | T##Toxic||N##Dangerous for the environment:; |
Risico-codes | R23/24/25||R33||R50:; |
Veiligheid Omschrijving | S28A||S37||S45||S61:; |
MSDS |