ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50703-06-5 Methyl thiazolidine-2-carboxylate hydrochloride |
|
Naam product | Methyl thiazolidine-2-carboxylate hydrochloride |
Engelse naam | Methyl thiazolidine-2-carboxylate hydrochloride;Thiazolidine-2-carboxylic acid methyl ester hydrochloride;methyl 1,3-thiazolidine-4-carboxylate hydrochloride (1:1) |
MF | C5H10ClNO2S |
Molecuulgewicht | 183.6564 |
InChI | InChI=1/C5H9NO2S.ClH/c1-8-5(7)4-2-9-3-6-4;/h4,6H,2-3H2,1H3;1H |
CAS-nummer | 50703-06-5 |
EINECS | 256-726-5 |
Moleculaire Structuur | ![]() |
Smeltpunt | 159-163℃ |
Kookpunt | 238.9°C at 760 mmHg |
Vlampunt | 98.3°C |
Dampdruk | 0.0413mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |