ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
Triacontanoic acid |
|
Naam product | Triacontanoic acid |
Engelse naam | Triacontanoic acid; |
MF | C30H60O2 |
Molecuulgewicht | 452.7962 |
InChI | InChI=1/C30H60O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21-22-23-24-25-26-27-28-29-30(31)32/h2-29H2,1H3,(H,31,32) |
CAS-nummer | 506-50-3 |
EINECS | 208-042-3 |
Moleculaire Structuur | |
Dichtheid | 0.873g/cm3 |
Smeltpunt | 91-94℃ |
Kookpunt | 441.4°C at 760 mmHg |
Brekingsindex | 1.462 |
Vlampunt | 196.9°C |
Dampdruk | 1.44E-08mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |