ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
506-24-1 stearolic acid |
|
Naam product | stearolic acid |
Engelse naam | stearolic acid;Octadec-9-ynoic acid |
MF | C18H32O2 |
Molecuulgewicht | 280.4455 |
InChI | InChI=1/C18H32O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)20/h2-8,11-17H2,1H3,(H,19,20) |
CAS-nummer | 506-24-1 |
EINECS | 208-030-8 |
Moleculaire Structuur | |
Dichtheid | 0.923g/cm3 |
Kookpunt | 405.2°C at 760 mmHg |
Brekingsindex | 1.471 |
Vlampunt | 196.3°C |
Dampdruk | 1.07E-07mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |