ChemIndex - Een gratis chemische CAS-databaseChina Business Portal|ChemNet|ChinaChemNet|ChinaChemical|KoreaChemNet
10-Nonadecanone |
|
Naam product | 10-Nonadecanone |
Engelse naam | 10-Nonadecanone;Di-n-nonyl ketone;nonadecan-10-one |
MF | C19H38O |
Molecuulgewicht | 282.5044 |
InChI | InChI=1/C19H38O/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h3-18H2,1-2H3 |
CAS-nummer | 504-57-4 |
EINECS | 207-994-7 |
Moleculaire Structuur | |
Dichtheid | 0.832g/cm3 |
Smeltpunt | 55-57℃ |
Kookpunt | 351.2°C at 760 mmHg |
Brekingsindex | 1.443 |
Vlampunt | 81.6°C |
Dampdruk | 4.17E-05mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |