ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
504-08-5 2,4-diamino-s-triazine |
|
Naam product | 2,4-diamino-s-triazine |
Synoniemen | ;D iaminotriazine; 1,3,5-triazine-2,4-diamine; 2,4-diamino-1,3,5-triazine; |
Engelse naam | 2,4-Diamino-s-triazine;Diaminotriazine;1,3,5-triazine-2,4-diamine;2,4-Diamino-1,3,5-Triazine |
MF | C3H5N5 |
Molecuulgewicht | 111.1053 |
InChI | InChI=1/C3H5N5/c4-2-6-1-7-3(5)8-2/h1H,(H4,4,5,6,7,8) |
CAS-nummer | 504-08-5 |
EINECS | 207-983-7 |
Moleculaire Structuur | |
Dichtheid | 1.508g/cm3 |
Kookpunt | 447.6°C at 760 mmHg |
Brekingsindex | 1.716 |
Vlampunt | 254.9°C |
Dampdruk | 3.32E-08mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |