ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
499771-17-4 2-[4-(2,3-dihydro-1,4-benzodioxine-6-yl)-1,3-thiazool-2-yl]acetonitril |
|
Naam product | 2-[4-(2,3-dihydro-1,4-benzodioxine-6-yl)-1,3-thiazool-2-yl]acetonitril |
Synoniemen | [4-(2,3-dihydro-1,4-benzodioxine-6-yl)-1,3-thiazool-2-yl]acetonitril; |
Engelse naam | 2-[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile;[4-(2,3-dihydro-1,4-benzodioxin-6-yl)-1,3-thiazol-2-yl]acetonitrile |
MF | C13H10N2O2S |
Molecuulgewicht | 258.2957 |
InChI | InChI=1/C13H10N2O2S/c14-4-3-13-15-10(8-18-13)9-1-2-11-12(7-9)17-6-5-16-11/h1-2,7-8H,3,5-6H2 |
CAS-nummer | 499771-17-4 |
Moleculaire Structuur | |
Dichtheid | 1.341g/cm3 |
Smeltpunt | 115℃ |
Kookpunt | 456.2°C at 760 mmHg |
Brekingsindex | 1.619 |
Vlampunt | 229.7°C |
Dampdruk | 1.65E-08mmHg at 25°C |
Gevaarsymbolen | Xn##Harmful:; |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Veiligheid Omschrijving | S36/37##Wear suitable protective clothing and gloves.:; |
MSDS |