ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
458-92-4 alpha,alpha-Difluoroanisole |
|
Naam product | alpha,alpha-Difluoroanisole |
Engelse naam | alpha,alpha-Difluoroanisole;(Difluoromethoxy)benzene |
MF | C7H6F2O |
Molecuulgewicht | 144.1187 |
InChI | InChI=1/C7H6F2O/c8-7(9)10-6-4-2-1-3-5-6/h1-5,7H |
CAS-nummer | 458-92-4 |
EINECS | 207-283-1 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.155g/cm3 |
Kookpunt | 138°C at 760 mmHg |
Brekingsindex | 1.445 |
Vlampunt | 43.1°C |
Dampdruk | 8.52mmHg at 25°C |
Risico-codes | R10##Flammable.:; |
Veiligheid Omschrijving | S23##Do not inhale gas/fumes/vapour/spray.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |