ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
455-37-8 3-fluorobenzamide |
|
Naam product | 3-fluorobenzamide |
Engelse naam | 3-fluorobenzamide;m-Fluorobenzamide |
MF | C7H6FNO |
Molecuulgewicht | 139.127 |
InChI | InChI=1/C7H6FNO/c8-6-3-1-2-5(4-6)7(9)10/h1-4H,(H2,9,10) |
CAS-nummer | 455-37-8 |
EINECS | 207-247-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.238g/cm3 |
Smeltpunt | 129-132℃ |
Kookpunt | 238.4°C at 760 mmHg |
Brekingsindex | 1.538 |
Vlampunt | 98°C |
Dampdruk | 0.0426mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |