ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4426-76-0 2-Isothiochroman-4-one |
|
Naam product | 2-Isothiochroman-4-one |
Engelse naam | 2-Isothiochroman-4-one;Isothiochromanone;NSC 208878;1H-2-Benzothiopyran-4(3H)-one (9CI);1H-isothiochromen-4(3H)-one |
MF | C9H8OS |
Molecuulgewicht | 164.2242 |
InChI | InChI=1/C9H8OS/c10-9-6-11-5-7-3-1-2-4-8(7)9/h1-4H,5-6H2 |
CAS-nummer | 4426-76-0 |
Moleculaire Structuur | |
Dichtheid | 1.241g/cm3 |
Kookpunt | 315.1°C at 760 mmHg |
Brekingsindex | 1.624 |
Vlampunt | 173.3°C |
Dampdruk | 0.000448mmHg at 25°C |
Veiligheid Omschrijving | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |