Chemindex > 4408-60-0
NL ▼
4408-60-0 2,4,6-Trimethylphenylacetic acid |
|
| Naam product | 2,4,6-Trimethylphenylacetic acid |
| Engelse naam | 2,4,6-Trimethylphenylacetic acid;Mesitylacetic acid;Mesityleneacetic acid;Mesity aceti acid;VITAS-BB TBB000369;RARECHEM AL BO 0305;BENZENEACETIC ACID, 2,4,6-TRIMETHYL-;2,4,6-TRIMETHYLBENZENEACETIC ACID;2,4,6-TMPAC;2,4,6-Trimethyl phenylacetic acid;(2,4,6-trimethylphenyl)acetate |
| MF | C11H13O2 |
| Molecuulgewicht | 177.2203 |
| InChI | InChI=1/C11H14O2/c1-7-4-8(2)10(6-11(12)13)9(3)5-7/h4-5H,6H2,1-3H3,(H,12,13)/p-1 |
| CAS-nummer | 4408-60-0 |
| EINECS | 224-556-0 |
| Moleculaire Structuur |  |
| Smeltpunt | 167-168℃ |
| Kookpunt | 312.9°C at 760 mmHg |
| Vlampunt | 210°C |
| Dampdruk | 0.000219mmHg at 25°C |
| Gevaarsymbolen |  Xi##Irritant:; |
| Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Bezoek ChemNet Mall om te informeren naar de prijs van
2,4,6-Trimethylphenylacetic acid 4408-60-0
Chemical CAS Database Service wordt geleverd door ChemIndex.com 