ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
42712-64-1 2-Amino-4-hydroxyquinoline hydrate |
|
Naam product | 2-Amino-4-hydroxyquinoline hydrate |
Engelse naam | 2-Amino-4-hydroxyquinoline hydrate;2-Aminoquinolinol hydrate;2-aminoquinolin-4(1H)-one;2-Amino-4-1H-quinolinone |
MF | C9H8N2O |
Molecuulgewicht | 160.1726 |
InChI | InChI=1/C9H8N2O/c10-9-5-8(12)6-3-1-2-4-7(6)11-9/h1-5H,(H3,10,11,12) |
CAS-nummer | 42712-64-1 |
Moleculaire Structuur | |
Dichtheid | 1.254g/cm3 |
Kookpunt | 294.1°C at 760 mmHg |
Brekingsindex | 1.623 |
Vlampunt | 131.7°C |
Dampdruk | 0.00166mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |