ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
402-64-2 3-fluorobenzal chloride |
|
Naam product | 3-fluorobenzal chloride |
Engelse naam | 3-fluorobenzal chloride;alpha,alpha-Dichloro-3-fluorotoluene |
MF | C7H5Cl2F |
Molecuulgewicht | 179.02 |
InChI | InChI=1/C7H5Cl2F/c8-7(9)5-2-1-3-6(10)4-5/h1-4,7H |
CAS-nummer | 402-64-2 |
EINECS | 206-952-5 |
Moleculaire Structuur | ![]() |
Kookpunt | 195℃ |
Risico-codes | R34##Causes burns.||R36##Irritating to eyes.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |