ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
401-56-9 ethylchlorofluoroacetate |
|
Naam product | ethylchlorofluoroacetate |
Engelse naam | ethylchlorofluoroacetate;Ethyl chlorofluoroacetate;Chlorofluoroacetic acid ethyl ester;ethyl (2S)-chloro(fluoro)ethanoate;ethyl (2R)-chloro(fluoro)ethanoate |
MF | C4H6ClFO2 |
Molecuulgewicht | 140.5406 |
InChI | InChI=1/C4H6ClFO2/c1-2-8-4(7)3(5)6/h3H,2H2,1H3/t3-/m0/s1 |
CAS-nummer | 401-56-9 |
EINECS | 206-930-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.219g/cm3 |
Kookpunt | 129°C at 760 mmHg |
Brekingsindex | 1.39 |
Vlampunt | 44.3°C |
Dampdruk | 10.4mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R34##Causes burns.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |