ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39978-14-8 Methyl 3-aminothiophene-4-carboxylate hydrochloride |
|
Naam product | Methyl 3-aminothiophene-4-carboxylate hydrochloride |
Engelse naam | Methyl 3-aminothiophene-4-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate hydrochloride;methyl 4-aminothiophene-3-carboxylate |
MF | C6H7NO2S |
Molecuulgewicht | 157.1903 |
InChI | InChI=1/C6H7NO2S/c1-9-6(8)4-2-10-3-5(4)7/h2-3H,7H2,1H3 |
CAS-nummer | 39978-14-8 |
Moleculaire Structuur | |
Dichtheid | 1.319g/cm3 |
Smeltpunt | 203℃ |
Kookpunt | 295.9°C at 760 mmHg |
Brekingsindex | 1.598 |
Vlampunt | 132.8°C |
Dampdruk | 0.00148mmHg at 25°C |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |