ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
39493-62-4 Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
|
Naam product | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate |
Engelse naam | Methyl 4-hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate;5,6-Dihydroorsellinic acid methyl ester~4-Hydroxy-6-methyl-2-oxo-3-cyclohexene-1-carboxylate methyl ester~Methyl 5-methylcyclohexene-1,3-dione-4-carboxylate;methyl 4-hydroxy-6-methyl-2-oxocyclohex-3-ene-1-carboxylate |
MF | C9H12O4 |
Molecuulgewicht | 184.1892 |
InChI | InChI=1/C9H12O4/c1-5-3-6(10)4-7(11)8(5)9(12)13-2/h4-5,8,10H,3H2,1-2H3 |
CAS-nummer | 39493-62-4 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.237g/cm3 |
Kookpunt | 289.4°C at 760 mmHg |
Brekingsindex | 1.511 |
Vlampunt | 113°C |
Dampdruk | 0.000243mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |