ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
38690-76-5 4-cyanofenyl-4-heptylbenzoaat |
|
Naam product | 4-cyanofenyl-4-heptylbenzoaat |
Synoniemen | 4-n-Heptylbenzoëzuur, 4-Cyanofenylester; |
Engelse naam | 4-Cyanophenyl 4-heptylbenzoate;4-n-Heptylbenzoic acid 4-Cyanophenyl ester |
MF | C21H23NO2 |
Molecuulgewicht | 321.4128 |
InChI | InChI=1/C21H23NO2/c1-2-3-4-5-6-7-17-8-12-19(13-9-17)21(23)24-20-14-10-18(16-22)11-15-20/h8-15H,2-7H2,1H3 |
CAS-nummer | 38690-76-5 |
EINECS | 254-084-0 |
Moleculaire Structuur | |
Dichtheid | 1.09g/cm3 |
Smeltpunt | 43-45℃ |
Kookpunt | 476.4°C at 760 mmHg |
Brekingsindex | 1.56 |
Vlampunt | 238.3°C |
Dampdruk | 3.07E-09mmHg at 25°C |
Gevaarsymbolen | Xn##Harmful:; |
Risico-codes | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.:; |
Veiligheid Omschrijving | S24/25##Avoid contact with skin and eyes.:; |
MSDS |