Chemindex > 370-81-0
NL ▼
370-81-0 Oxalic acid bis(cyclohexylidenehydrazide) |
|
| Naam product | Oxalic acid bis(cyclohexylidenehydrazide) |
| Engelse naam | Oxalic acid bis(cyclohexylidenehydrazide);Cuprizon 1;Bis(cyclohexanone)oxaldihydrazone;oxalic bis(cyclohexylidenehydrazide);N,N-oxalylbis(cyclohexanone hydrazone);Cuprizon l;cuprizon;Oxalic acid bis (cyclohexylidenehydrazide);N'~1~,N'~2~-dicyclohexylideneethanedihydrazide |
| MF | C14H22N4O2 |
| Molecuulgewicht | 278.3501 |
| InChI | InChI=1/C14H22N4O2/c19-13(17-15-11-7-3-1-4-8-11)14(20)18-16-12-9-5-2-6-10-12/h1-10H2,(H,17,19)(H,18,20) |
| CAS-nummer | 370-81-0 |
| EINECS | 206-729-2 |
| Moleculaire Structuur |  |
| Dichtheid | 1.29g/cm3 |
| Smeltpunt | 208-214℃ |
| Brekingsindex | 1.625 |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R21/22##Harmful in contact with skin and if swallowed.:; |
| Veiligheid Omschrijving | S2##Keep out of reach of children||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Bezoek ChemNet Mall om te informeren naar de prijs van
Oxalic acid bis(cyclohexylidenehydrazide) 370-81-0
Chemical CAS Database Service wordt geleverd door ChemIndex.com 