Chemindex > 36919-03-6
NL â–¼
36919-03-6 Methyl pentafluorophenyl carbonate |
|
| Naam product | Methyl pentafluorophenyl carbonate |
| Engelse naam | Methyl pentafluorophenyl carbonate;Pentafluorophenyl methyl carbonate |
| MF | C8H3F5O3 |
| Molecuulgewicht | 242.0996 |
| InChI | InChI=1/C8H3F5O3/c1-15-8(14)16-7-5(12)3(10)2(9)4(11)6(7)13/h1H3 |
| CAS-nummer | 36919-03-6 |
| Moleculaire Structuur |  |
| Dichtheid | 1.567g/cm3 |
| Kookpunt | 207.5°C at 760 mmHg |
| Brekingsindex | 1.422 |
| Vlampunt | 77.3°C |
| Dampdruk | 0.224mmHg at 25°C |
| Risico-codes | R22##Harmful if swallowed.||R36/38##Irritating to eyes and skin.:; |
| Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Leveranciers voor 36919-03-6 (0):
Chemical CAS Database Service wordt geleverd door ChemIndex.com 