Chemindex > 349-01-9
NL ▼
2,4-dinitro-5-fluorotoluene |
|
| Naam product | 2,4-dinitro-5-fluorotoluene |
| Engelse naam | 2,4-dinitro-5-fluorotoluene;1-Fluoro-5-methyl-2,4-dinitrobenzene |
| MF | C7H5FN2O4 |
| Molecuulgewicht | 200.124 |
| InChI | InChI=1/C7H5FN2O4/c1-4-2-5(8)7(10(13)14)3-6(4)9(11)12/h2-3H,1H3 |
| CAS-nummer | 349-01-9 |
| Moleculaire Structuur |  |
| Dichtheid | 1.497g/cm3 |
| Smeltpunt | 82℃ |
| Kookpunt | 319°C at 760 mmHg |
| Brekingsindex | 1.575 |
| Vlampunt | 146.8°C |
| Dampdruk | 0.000649mmHg at 25°C |
| Gevaarsymbolen |  T##Toxic:; |
| Risico-codes | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.:; |
| Veiligheid Omschrijving | S28A##After contact with skin, wash immediately with plenty of water.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S38##In case of insufficient ventilation, wear suitable respiratory equipment.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 