ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
345-70-0 3,3'-difluorobenzophenone |
|
Naam product | 3,3'-difluorobenzophenone |
Engelse naam | 3,3'-difluorobenzophenone;bis(3-fluorophenyl)methanone |
MF | C13H8F2O |
Molecuulgewicht | 218.1988 |
InChI | InChI=1/C13H8F2O/c14-11-5-1-3-9(7-11)13(16)10-4-2-6-12(15)8-10/h1-8H |
CAS-nummer | 345-70-0 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.239g/cm3 |
Smeltpunt | 56-59℃ |
Kookpunt | 316.2°C at 760 mmHg |
Brekingsindex | 1.549 |
Vlampunt | 121.3°C |
Dampdruk | 0.000415mmHg at 25°C |
Risico-codes | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Veiligheid Omschrijving | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
MSDS |