Chemindex > 341-69-5
NL ▼
341-69-5 Orphenadrine hydrochloride |
|
| Naam product | Orphenadrine hydrochloride |
| Engelse naam | Orphenadrine hydrochloride;N,N-Dimethyl-2-(o-methyl-alpha-phenylbenzyloxy)-ethylamine hydrochloride;N,N-dimethyl-2-[(2-methylphenyl)(phenyl)methoxy]ethanamine hydrochloride (1:1);N,N-dimethyl-2-[(R)-(2-methylphenyl)(phenyl)methoxy]ethanaminium;N,N-dimethyl-2-[(S)-(2-methylphenyl)(phenyl)methoxy]ethanaminium |
| MF | C18H24NO |
| Molecuulgewicht | 270.3887 |
| InChI | InChI=1/C18H23NO/c1-15-9-7-8-12-17(15)18(20-14-13-19(2)3)16-10-5-4-6-11-16/h4-12,18H,13-14H2,1-3H3/p+1/t18-/m0/s1 |
| CAS-nummer | 341-69-5 |
| EINECS | 206-435-4 |
| Moleculaire Structuur |  |
| Smeltpunt | 159-162℃ |
| Kookpunt | 363°C at 760 mmHg |
| Vlampunt | 107.1°C |
| Dampdruk | 1.86E-05mmHg at 25°C |
| Gevaarsymbolen |  Xn##Harmful:; |
| Risico-codes | R20/21##Harmful by inhalation and in contact with skin.:; |
| Veiligheid Omschrijving | S23##Do not inhale gas/fumes/vapour/spray.:; |
| MSDS | |
- Als u van plan bent om chemicaliën uit China te halen, ga dan naar het winkelcentrum ChemNet, we krijgen de nieuwste en concurrerende prijs van Chinese fabrikanten voor u.Ga naar
ChemNet Mall
Chemical CAS Database Service wordt geleverd door ChemIndex.com 