ChemIndex - Een gratis chemische CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
332-77-4 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
|
Naam product | 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans |
Engelse naam | 2,5-Dimethoxy-2,5-dihydrofuran, mixture ofcis and trans;2,5-Dihydro-2,5-dimethoxyfuran;2,5-Dimethoxy-2,5-dihydrofuran;(2R,5R)-2,5-dimethoxy-2,5-dihydrofuran;(2R,5S)-2,5-dimethoxy-2,5-dihydrofuran;(2S,5S)-2,5-dimethoxy-2,5-dihydrofuran |
MF | C6H10O3 |
Molecuulgewicht | 130.1418 |
InChI | InChI=1/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m0/s1 |
CAS-nummer | 332-77-4 |
EINECS | 206-367-5 |
Moleculaire Structuur | ![]() |
Dichtheid | 1.06g/cm3 |
Kookpunt | 161°C at 760 mmHg |
Brekingsindex | 1.448 |
Vlampunt | 47.2°C |
Dampdruk | 3.02mmHg at 25°C |
Gevaarsymbolen | |
Risico-codes | R10:; |
Veiligheid Omschrijving | S16##Keep away from sources of ignition - No smoking.||S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S39##Wear eye/face protection.:; |
MSDS |